C10H11N5S2 — CID 114127834
2-[(5-methyl-1,3-thiazol-2-yl)methylamino]pyrimidine-4-carbothioamide (PubChem CID 114127834) has the molecular formula C10H11N5S2 and a molecular weight of 265.37 g/mol. Its IUPAC name is 2-[(5-methyl-1,3-thiazol-2-yl)methylamino]pyrimidine-4-carbothioamide.
| Compound Name | 2-[(5-methyl-1,3-thiazol-2-yl)methylamino]pyrimidine-4-carbothioamide |
|---|---|
| PubChem CID | 114127834 |
| Molecular Formula | C10H11N5S2 |
| Molecular Weight | 265.37 g/mol |
| Exact Mass | 265.05 |
| IUPAC Name | 2-[(5-methyl-1,3-thiazol-2-yl)methylamino]pyrimidine-4-carbothioamide |
| SMILES | Cc1cnc(CNc2nccc(C(N)=S)n2)s1 |
| InChI | InChI=1S/C10H11N5S2/c1-6-4-13-8(17-6)5-14-10-12-3-2-7(15-10)9(11)16/h2-4H,5H2,1H3,(H2,11,16)(H,12,14,15) |
| InChIKey | TUEUZVVCCYYSSQ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.37 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|