C10H15N5OS — CID 114162241
5-[(4-carbamothioylpyrimidin-2-yl)amino]pentanamide (PubChem CID 114162241) has the molecular formula C10H15N5OS and a molecular weight of 253.33 g/mol. Its IUPAC name is 5-[(4-carbamothioylpyrimidin-2-yl)amino]pentanamide.
| Compound Name | 5-[(4-carbamothioylpyrimidin-2-yl)amino]pentanamide |
|---|---|
| PubChem CID | 114162241 |
| Molecular Formula | C10H15N5OS |
| Molecular Weight | 253.33 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | 5-[(4-carbamothioylpyrimidin-2-yl)amino]pentanamide |
| SMILES | NC(=O)CCCCNc1nccc(C(N)=S)n1 |
| InChI | InChI=1S/C10H15N5OS/c11-8(16)3-1-2-5-13-10-14-6-4-7(15-10)9(12)17/h4,6H,1-3,5H2,(H2,11,16)(H2,12,17)(H,13,14,15) |
| InChIKey | XFIIKFLTYQWKAE-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.33 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|