C9H15N5O2S2 — CID 106339028
2-[3-(methanesulfonamido)propylamino]pyrimidine-4-carbothioamide (PubChem CID 106339028) has the molecular formula C9H15N5O2S2 and a molecular weight of 289.39 g/mol. Its IUPAC name is 2-[3-(methanesulfonamido)propylamino]pyrimidine-4-carbothioamide.
| Compound Name | 2-[3-(methanesulfonamido)propylamino]pyrimidine-4-carbothioamide |
|---|---|
| PubChem CID | 106339028 |
| Molecular Formula | C9H15N5O2S2 |
| Molecular Weight | 289.39 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 2-[3-(methanesulfonamido)propylamino]pyrimidine-4-carbothioamide |
| SMILES | CS(=O)(=O)NCCCNc1nccc(C(N)=S)n1 |
| InChI | InChI=1S/C9H15N5O2S2/c1-18(15,16)13-5-2-4-11-9-12-6-3-7(14-9)8(10)17/h3,6,13H,2,4-5H2,1H3,(H2,10,17)(H,11,12,14) |
| InChIKey | HDNUHHNFZSTXLJ-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.39 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|