C10H17N5S — CID 107547316
2-[2-[ethyl(methyl)amino]ethylamino]pyrimidine-4-carbothioamide (PubChem CID 107547316) has the molecular formula C10H17N5S and a molecular weight of 239.35 g/mol. Its IUPAC name is 2-[2-[ethyl(methyl)amino]ethylamino]pyrimidine-4-carbothioamide.
| Compound Name | 2-[2-[ethyl(methyl)amino]ethylamino]pyrimidine-4-carbothioamide |
|---|---|
| PubChem CID | 107547316 |
| Molecular Formula | C10H17N5S |
| Molecular Weight | 239.35 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | 2-[2-[ethyl(methyl)amino]ethylamino]pyrimidine-4-carbothioamide |
| SMILES | CCN(C)CCNc1nccc(C(N)=S)n1 |
| InChI | InChI=1S/C10H17N5S/c1-3-15(2)7-6-13-10-12-5-4-8(14-10)9(11)16/h4-5H,3,6-7H2,1-2H3,(H2,11,16)(H,12,13,14) |
| InChIKey | SLOZUECCDDCOLZ-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.35 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|