C9H14N4O4S — CID 106342754
2-[3-(methanesulfonamido)propylamino]pyrimidine-4-carboxylic acid (PubChem CID 106342754) has the molecular formula C9H14N4O4S and a molecular weight of 274.30 g/mol. Its IUPAC name is 2-[3-(methanesulfonamido)propylamino]pyrimidine-4-carboxylic acid.
| Compound Name | 2-[3-(methanesulfonamido)propylamino]pyrimidine-4-carboxylic acid |
|---|---|
| PubChem CID | 106342754 |
| Molecular Formula | C9H14N4O4S |
| Molecular Weight | 274.30 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | 2-[3-(methanesulfonamido)propylamino]pyrimidine-4-carboxylic acid |
| SMILES | CS(=O)(=O)NCCCNc1nccc(C(=O)O)n1 |
| InChI | InChI=1S/C9H14N4O4S/c1-18(16,17)12-5-2-4-10-9-11-6-3-7(13-9)8(14)15/h3,6,12H,2,4-5H2,1H3,(H,14,15)(H,10,11,13) |
| InChIKey | XSUMKWLPIIPKFI-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 121.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.30 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|