C10H11ClFN5 — CID 114124749
4-chloro-5-fluoro-1-N-[(1-methyl-1,2,4-triazol-3-yl)methyl]benzene-1,2-diamine (PubChem CID 114124749) has the molecular formula C10H11ClFN5 and a molecular weight of 255.68 g/mol. Its IUPAC name is 4-chloro-5-fluoro-1-N-[(1-methyl-1,2,4-triazol-3-yl)methyl]benzene-1,2-diamine.
| Compound Name | 4-chloro-5-fluoro-1-N-[(1-methyl-1,2,4-triazol-3-yl)methyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 114124749 |
| Molecular Formula | C10H11ClFN5 |
| Molecular Weight | 255.68 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | 4-chloro-5-fluoro-1-N-[(1-methyl-1,2,4-triazol-3-yl)methyl]benzene-1,2-diamine |
| SMILES | Cn1cnc(CNc2cc(F)c(Cl)cc2N)n1 |
| InChI | InChI=1S/C10H11ClFN5/c1-17-5-15-10(16-17)4-14-9-3-7(12)6(11)2-8(9)13/h2-3,5,14H,4,13H2,1H3 |
| InChIKey | GWAVCFQQLYBWSQ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.68 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|