C11H13ClFN5 — CID 114170726
4-chloro-2-N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-5-fluorobenzene-1,2-diamine (PubChem CID 114170726) has the molecular formula C11H13ClFN5 and a molecular weight of 269.71 g/mol. Its IUPAC name is 4-chloro-2-N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-5-fluorobenzene-1,2-diamine.
| Compound Name | 4-chloro-2-N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-5-fluorobenzene-1,2-diamine |
|---|---|
| PubChem CID | 114170726 |
| Molecular Formula | C11H13ClFN5 |
| Molecular Weight | 269.71 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 4-chloro-2-N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-5-fluorobenzene-1,2-diamine |
| SMILES | CCn1cnnc1CNc1cc(Cl)c(F)cc1N |
| InChI | InChI=1S/C11H13ClFN5/c1-2-18-6-16-17-11(18)5-15-10-3-7(12)8(13)4-9(10)14/h3-4,6,15H,2,5,14H2,1H3 |
| InChIKey | PTUIYFOEDJITSH-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.71 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|