C11H14IN5 — CID 114170703
1-N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-2-iodobenzene-1,4-diamine (PubChem CID 114170703) has the molecular formula C11H14IN5 and a molecular weight of 343.17 g/mol. Its IUPAC name is 1-N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-2-iodobenzene-1,4-diamine.
| Compound Name | 1-N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-2-iodobenzene-1,4-diamine |
|---|---|
| PubChem CID | 114170703 |
| Molecular Formula | C11H14IN5 |
| Molecular Weight | 343.17 g/mol |
| Exact Mass | 343.03 |
| IUPAC Name | 1-N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-2-iodobenzene-1,4-diamine |
| SMILES | CCn1cnnc1CNc1ccc(N)cc1I |
| InChI | InChI=1S/C11H14IN5/c1-2-17-7-15-16-11(17)6-14-10-4-3-8(13)5-9(10)12/h3-5,7,14H,2,6,13H2,1H3 |
| InChIKey | MOOVIOIULGXALN-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.17 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|