C13H18N6O — CID 106302003
4-amino-2-[(4-ethyl-1,2,4-triazol-3-yl)methylamino]-N-methylbenzamide (PubChem CID 106302003) has the molecular formula C13H18N6O and a molecular weight of 274.33 g/mol. Its IUPAC name is 4-amino-2-[(4-ethyl-1,2,4-triazol-3-yl)methylamino]-N-methylbenzamide.
| Compound Name | 4-amino-2-[(4-ethyl-1,2,4-triazol-3-yl)methylamino]-N-methylbenzamide |
|---|---|
| PubChem CID | 106302003 |
| Molecular Formula | C13H18N6O |
| Molecular Weight | 274.33 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | 4-amino-2-[(4-ethyl-1,2,4-triazol-3-yl)methylamino]-N-methylbenzamide |
| SMILES | CCn1cnnc1CNc1cc(N)ccc1C(=O)NC |
| InChI | InChI=1S/C13H18N6O/c1-3-19-8-17-18-12(19)7-16-11-6-9(14)4-5-10(11)13(20)15-2/h4-6,8,16H,3,7,14H2,1-2H3,(H,15,20) |
| InChIKey | QLXDHESLKIZSQK-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 97.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.33 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|