C13H17N5OS — CID 106302998
2-[(4-ethyl-1,2,4-triazol-3-yl)methylamino]-4-methoxybenzenecarbothioamide (PubChem CID 106302998) has the molecular formula C13H17N5OS and a molecular weight of 291.38 g/mol. Its IUPAC name is 2-[(4-ethyl-1,2,4-triazol-3-yl)methylamino]-4-methoxybenzenecarbothioamide.
| Compound Name | 2-[(4-ethyl-1,2,4-triazol-3-yl)methylamino]-4-methoxybenzenecarbothioamide |
|---|---|
| PubChem CID | 106302998 |
| Molecular Formula | C13H17N5OS |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | 2-[(4-ethyl-1,2,4-triazol-3-yl)methylamino]-4-methoxybenzenecarbothioamide |
| SMILES | CCn1cnnc1CNc1cc(OC)ccc1C(N)=S |
| InChI | InChI=1S/C13H17N5OS/c1-3-18-8-16-17-12(18)7-15-11-6-9(19-2)4-5-10(11)13(14)20/h4-6,8,15H,3,7H2,1-2H3,(H2,14,20) |
| InChIKey | NNBFNVZDDCVIGS-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|