C12H14BrN5S — CID 106303033
3-bromo-4-[(4-ethyl-1,2,4-triazol-3-yl)methylamino]benzenecarbothioamide (PubChem CID 106303033) has the molecular formula C12H14BrN5S and a molecular weight of 340.25 g/mol. Its IUPAC name is 3-bromo-4-[(4-ethyl-1,2,4-triazol-3-yl)methylamino]benzenecarbothioamide.
| Compound Name | 3-bromo-4-[(4-ethyl-1,2,4-triazol-3-yl)methylamino]benzenecarbothioamide |
|---|---|
| PubChem CID | 106303033 |
| Molecular Formula | C12H14BrN5S |
| Molecular Weight | 340.25 g/mol |
| Exact Mass | 339.02 |
| IUPAC Name | 3-bromo-4-[(4-ethyl-1,2,4-triazol-3-yl)methylamino]benzenecarbothioamide |
| SMILES | CCn1cnnc1CNc1ccc(C(N)=S)cc1Br |
| InChI | InChI=1S/C12H14BrN5S/c1-2-18-7-16-17-11(18)6-15-10-4-3-8(12(14)19)5-9(10)13/h3-5,7,15H,2,6H2,1H3,(H2,14,19) |
| InChIKey | AZFLHNNENOMEKD-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.25 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|