C12H17BrN2S — CID 82805271
3-bromo-4-(2,2-dimethylpropylamino)benzenecarbothioamide (PubChem CID 82805271) has the molecular formula C12H17BrN2S and a molecular weight of 301.25 g/mol. Its IUPAC name is 3-bromo-4-(2,2-dimethylpropylamino)benzenecarbothioamide.
| Compound Name | 3-bromo-4-(2,2-dimethylpropylamino)benzenecarbothioamide |
|---|---|
| PubChem CID | 82805271 |
| Molecular Formula | C12H17BrN2S |
| Molecular Weight | 301.25 g/mol |
| Exact Mass | 300.03 |
| IUPAC Name | 3-bromo-4-(2,2-dimethylpropylamino)benzenecarbothioamide |
| SMILES | CC(C)(C)CNc1ccc(C(N)=S)cc1Br |
| InChI | InChI=1S/C12H17BrN2S/c1-12(2,3)7-15-10-5-4-8(11(14)16)6-9(10)13/h4-6,15H,7H2,1-3H3,(H2,14,16) |
| InChIKey | DZSAZDBVDDTXFH-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.25 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|