C11H16BrN3O2S2 — CID 107790171
3-bromo-4-(tert-butylsulfamoylamino)benzenecarbothioamide (PubChem CID 107790171) has the molecular formula C11H16BrN3O2S2 and a molecular weight of 366.31 g/mol. Its IUPAC name is 3-bromo-4-(tert-butylsulfamoylamino)benzenecarbothioamide.
| Compound Name | 3-bromo-4-(tert-butylsulfamoylamino)benzenecarbothioamide |
|---|---|
| PubChem CID | 107790171 |
| Molecular Formula | C11H16BrN3O2S2 |
| Molecular Weight | 366.31 g/mol |
| Exact Mass | 364.99 |
| IUPAC Name | 3-bromo-4-(tert-butylsulfamoylamino)benzenecarbothioamide |
| SMILES | CC(C)(C)NS(=O)(=O)Nc1ccc(C(N)=S)cc1Br |
| InChI | InChI=1S/C11H16BrN3O2S2/c1-11(2,3)15-19(16,17)14-9-5-4-7(10(13)18)6-8(9)12/h4-6,14-15H,1-3H3,(H2,13,18) |
| InChIKey | YJYJWZYNLAHAJE-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.31 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|