C12H17BrN4S — CID 83015687
3-bromo-4-[(4-methylpiperazin-1-yl)amino]benzenecarbothioamide (PubChem CID 83015687) has the molecular formula C12H17BrN4S and a molecular weight of 329.27 g/mol. Its IUPAC name is 3-bromo-4-[(4-methylpiperazin-1-yl)amino]benzenecarbothioamide.
| Compound Name | 3-bromo-4-[(4-methylpiperazin-1-yl)amino]benzenecarbothioamide |
|---|---|
| PubChem CID | 83015687 |
| Molecular Formula | C12H17BrN4S |
| Molecular Weight | 329.27 g/mol |
| Exact Mass | 328.04 |
| IUPAC Name | 3-bromo-4-[(4-methylpiperazin-1-yl)amino]benzenecarbothioamide |
| SMILES | CN1CCN(Nc2ccc(C(N)=S)cc2Br)CC1 |
| InChI | InChI=1S/C12H17BrN4S/c1-16-4-6-17(7-5-16)15-11-3-2-9(12(14)18)8-10(11)13/h2-3,8,15H,4-7H2,1H3,(H2,14,18) |
| InChIKey | NQTLHWRCSTZPRY-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.27 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|