C13H18BrN3OS — CID 82803789
3-bromo-4-(2-morpholin-4-ylethylamino)benzenecarbothioamide (PubChem CID 82803789) has the molecular formula C13H18BrN3OS and a molecular weight of 344.28 g/mol. Its IUPAC name is 3-bromo-4-(2-morpholin-4-ylethylamino)benzenecarbothioamide.
| Compound Name | 3-bromo-4-(2-morpholin-4-ylethylamino)benzenecarbothioamide |
|---|---|
| PubChem CID | 82803789 |
| Molecular Formula | C13H18BrN3OS |
| Molecular Weight | 344.28 g/mol |
| Exact Mass | 343.04 |
| IUPAC Name | 3-bromo-4-(2-morpholin-4-ylethylamino)benzenecarbothioamide |
| SMILES | NC(=S)c1ccc(NCCN2CCOCC2)c(Br)c1 |
| InChI | InChI=1S/C13H18BrN3OS/c14-11-9-10(13(15)19)1-2-12(11)16-3-4-17-5-7-18-8-6-17/h1-2,9,16H,3-8H2,(H2,15,19) |
| InChIKey | VKLBDEJJAUUDDX-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.28 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|