C12H18ClN3O — CID 28904413
2-chloro-1-N-(2-morpholin-4-ylethyl)benzene-1,4-diamine (PubChem CID 28904413) has the molecular formula C12H18ClN3O and a molecular weight of 255.75 g/mol. Its IUPAC name is 2-chloro-1-N-(2-morpholin-4-ylethyl)benzene-1,4-diamine.
| Compound Name | 2-chloro-1-N-(2-morpholin-4-ylethyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 28904413 |
| Molecular Formula | C12H18ClN3O |
| Molecular Weight | 255.75 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | 2-chloro-1-N-(2-morpholin-4-ylethyl)benzene-1,4-diamine |
| SMILES | Nc1ccc(NCCN2CCOCC2)c(Cl)c1 |
| InChI | InChI=1S/C12H18ClN3O/c13-11-9-10(14)1-2-12(11)15-3-4-16-5-7-17-8-6-16/h1-2,9,15H,3-8,14H2 |
| InChIKey | KBVMQRFPOQRCMZ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.75 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|