C11H16Cl2N4O — CID 102755704
3,5-dichloro-6-N-(2-morpholin-4-ylethyl)pyridine-2,6-diamine (PubChem CID 102755704) has the molecular formula C11H16Cl2N4O and a molecular weight of 291.18 g/mol. Its IUPAC name is 3,5-dichloro-6-N-(2-morpholin-4-ylethyl)pyridine-2,6-diamine.
| Compound Name | 3,5-dichloro-6-N-(2-morpholin-4-ylethyl)pyridine-2,6-diamine |
|---|---|
| PubChem CID | 102755704 |
| Molecular Formula | C11H16Cl2N4O |
| Molecular Weight | 291.18 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 3,5-dichloro-6-N-(2-morpholin-4-ylethyl)pyridine-2,6-diamine |
| SMILES | Nc1nc(NCCN2CCOCC2)c(Cl)cc1Cl |
| InChI | InChI=1S/C11H16Cl2N4O/c12-8-7-9(13)11(16-10(8)14)15-1-2-17-3-5-18-6-4-17/h7H,1-6H2,(H3,14,15,16) |
| InChIKey | PBQDFFYQQQWVJZ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 63.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.18 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |