C9H13Cl2N3O — CID 106847028
4-[(6-amino-3,5-dichloro-2-pyridinyl)amino]butan-1-ol (PubChem CID 106847028) has the molecular formula C9H13Cl2N3O and a molecular weight of 250.13 g/mol. Its IUPAC name is 4-[(6-amino-3,5-dichloro-2-pyridinyl)amino]butan-1-ol.
| Compound Name | 4-[(6-amino-3,5-dichloro-2-pyridinyl)amino]butan-1-ol |
|---|---|
| PubChem CID | 106847028 |
| Molecular Formula | C9H13Cl2N3O |
| Molecular Weight | 250.13 g/mol |
| Exact Mass | 249.04 |
| IUPAC Name | 4-[(6-amino-3,5-dichloro-2-pyridinyl)amino]butan-1-ol |
| SMILES | Nc1nc(NCCCCO)c(Cl)cc1Cl |
| InChI | InChI=1S/C9H13Cl2N3O/c10-6-5-7(11)9(14-8(6)12)13-3-1-2-4-15/h5,15H,1-4H2,(H3,12,13,14) |
| InChIKey | ZNLRJJKRVVBXIY-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.13 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|