C7H9Cl2N3 — CID 102755516
3,5-dichloro-6-N-ethylpyridine-2,6-diamine (PubChem CID 102755516) has the molecular formula C7H9Cl2N3 and a molecular weight of 206.08 g/mol. Its IUPAC name is 3,5-dichloro-6-N-ethylpyridine-2,6-diamine.
| Compound Name | 3,5-dichloro-6-N-ethylpyridine-2,6-diamine |
|---|---|
| PubChem CID | 102755516 |
| Molecular Formula | C7H9Cl2N3 |
| Molecular Weight | 206.08 g/mol |
| Exact Mass | 205.02 |
| IUPAC Name | 3,5-dichloro-6-N-ethylpyridine-2,6-diamine |
| SMILES | CCNc1nc(N)c(Cl)cc1Cl |
| InChI | InChI=1S/C7H9Cl2N3/c1-2-11-7-5(9)3-4(8)6(10)12-7/h3H,2H2,1H3,(H3,10,11,12) |
| InChIKey | IMLRQTYQZJJJLU-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.08 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |