C9H11Cl2N3 — CID 102759897
3,5-dichloro-6-N-(1-methylcyclopropyl)pyridine-2,6-diamine (PubChem CID 102759897) has the molecular formula C9H11Cl2N3 and a molecular weight of 232.11 g/mol. Its IUPAC name is 3,5-dichloro-6-N-(1-methylcyclopropyl)pyridine-2,6-diamine.
| Compound Name | 3,5-dichloro-6-N-(1-methylcyclopropyl)pyridine-2,6-diamine |
|---|---|
| PubChem CID | 102759897 |
| Molecular Formula | C9H11Cl2N3 |
| Molecular Weight | 232.11 g/mol |
| Exact Mass | 231.03 |
| IUPAC Name | 3,5-dichloro-6-N-(1-methylcyclopropyl)pyridine-2,6-diamine |
| SMILES | CC1(Nc2nc(N)c(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C9H11Cl2N3/c1-9(2-3-9)14-8-6(11)4-5(10)7(12)13-8/h4H,2-3H2,1H3,(H3,12,13,14) |
| InChIKey | CAHLYOOKRRJNPB-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.11 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |