C15H19Cl2N3 — CID 102754866
6-N-(1-adamantyl)-3,5-dichloropyridine-2,6-diamine (PubChem CID 102754866) has the molecular formula C15H19Cl2N3 and a molecular weight of 312.24 g/mol. Its IUPAC name is 6-N-(1-adamantyl)-3,5-dichloropyridine-2,6-diamine.
| Compound Name | 6-N-(1-adamantyl)-3,5-dichloropyridine-2,6-diamine |
|---|---|
| PubChem CID | 102754866 |
| Molecular Formula | C15H19Cl2N3 |
| Molecular Weight | 312.24 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | 6-N-(1-adamantyl)-3,5-dichloropyridine-2,6-diamine |
| SMILES | Nc1nc(NC23CC4CC(CC(C4)C2)C3)c(Cl)cc1Cl |
| InChI | InChI=1S/C15H19Cl2N3/c16-11-4-12(17)14(19-13(11)18)20-15-5-8-1-9(6-15)3-10(2-8)7-15/h4,8-10H,1-3,5-7H2,(H3,18,19,20) |
| InChIKey | LJOPTZRVPNTOHX-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.24 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |