C21H26ClN5 — CID 19143547
4-N-(1-adamantyl)-6-N-[(2-chlorophenyl)methyl]pyrimidine-4,5,6-triamine (PubChem CID 19143547) has the molecular formula C21H26ClN5 and a molecular weight of 383.93 g/mol. Its IUPAC name is 4-N-(1-adamantyl)-6-N-[(2-chlorophenyl)methyl]pyrimidine-4,5,6-triamine.
| Compound Name | 4-N-(1-adamantyl)-6-N-[(2-chlorophenyl)methyl]pyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 19143547 |
| Molecular Formula | C21H26ClN5 |
| Molecular Weight | 383.93 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | 4-N-(1-adamantyl)-6-N-[(2-chlorophenyl)methyl]pyrimidine-4,5,6-triamine |
| SMILES | Nc1c(NCc2ccccc2Cl)ncnc1NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C21H26ClN5/c22-17-4-2-1-3-16(17)11-24-19-18(23)20(26-12-25-19)27-21-8-13-5-14(9-21)7-15(6-13)10-21/h1-4,12-15H,5-11,23H2,(H2,24,25,26,27) |
| InChIKey | ZNXGYDJWRYLCQV-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.93 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |