C17H21ClN4O — CID 19154177
4-N-[(2-chlorophenyl)methyl]-6-cyclohexyloxypyrimidine-4,5-diamine (PubChem CID 19154177) has the molecular formula C17H21ClN4O and a molecular weight of 332.83 g/mol. Its IUPAC name is 4-N-[(2-chlorophenyl)methyl]-6-cyclohexyloxypyrimidine-4,5-diamine.
| Compound Name | 4-N-[(2-chlorophenyl)methyl]-6-cyclohexyloxypyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 19154177 |
| Molecular Formula | C17H21ClN4O |
| Molecular Weight | 332.83 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | 4-N-[(2-chlorophenyl)methyl]-6-cyclohexyloxypyrimidine-4,5-diamine |
| SMILES | Nc1c(NCc2ccccc2Cl)ncnc1OC1CCCCC1 |
| InChI | InChI=1S/C17H21ClN4O/c18-14-9-5-4-6-12(14)10-20-16-15(19)17(22-11-21-16)23-13-7-2-1-3-8-13/h4-6,9,11,13H,1-3,7-8,10,19H2,(H,20,21,22) |
| InChIKey | OCHDFLSHMJHQSF-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.83 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |