C16H18Cl2N4O — CID 22546948
6-cyclohexyloxy-4-N-(3,4-dichlorophenyl)pyrimidine-4,5-diamine (PubChem CID 22546948) has the molecular formula C16H18Cl2N4O and a molecular weight of 353.25 g/mol. Its IUPAC name is 6-cyclohexyloxy-4-N-(3,4-dichlorophenyl)pyrimidine-4,5-diamine.
| Compound Name | 6-cyclohexyloxy-4-N-(3,4-dichlorophenyl)pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 22546948 |
| Molecular Formula | C16H18Cl2N4O |
| Molecular Weight | 353.25 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | 6-cyclohexyloxy-4-N-(3,4-dichlorophenyl)pyrimidine-4,5-diamine |
| SMILES | Nc1c(Nc2ccc(Cl)c(Cl)c2)ncnc1OC1CCCCC1 |
| InChI | InChI=1S/C16H18Cl2N4O/c17-12-7-6-10(8-13(12)18)22-15-14(19)16(21-9-20-15)23-11-4-2-1-3-5-11/h6-9,11H,1-5,19H2,(H,20,21,22) |
| InChIKey | BKXXCCUTLIVEJV-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.25 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |