C17H21ClN4O — CID 22545500
4-N-(3-chloro-2-methylphenyl)-6-cyclohexyloxypyrimidine-4,5-diamine (PubChem CID 22545500) has the molecular formula C17H21ClN4O and a molecular weight of 332.84 g/mol. Its IUPAC name is 4-N-(3-chloro-2-methylphenyl)-6-cyclohexyloxypyrimidine-4,5-diamine.
| Compound Name | 4-N-(3-chloro-2-methylphenyl)-6-cyclohexyloxypyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 22545500 |
| Molecular Formula | C17H21ClN4O |
| Molecular Weight | 332.84 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | 4-N-(3-chloro-2-methylphenyl)-6-cyclohexyloxypyrimidine-4,5-diamine |
| SMILES | Cc1c(Cl)cccc1Nc1ncnc(OC2CCCCC2)c1N |
| InChI | InChI=1S/C17H21ClN4O/c1-11-13(18)8-5-9-14(11)22-16-15(19)17(21-10-20-16)23-12-6-3-2-4-7-12/h5,8-10,12H,2-4,6-7,19H2,1H3,(H,20,21,22) |
| InChIKey | KPUSNCZKICQWPU-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.84 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |