C13H18ClN — CID 29276475
3-chloro-N-cyclohexyl-2-methylaniline (PubChem CID 29276475) has the molecular formula C13H18ClN and a molecular weight of 223.75 g/mol. Its IUPAC name is 3-chloro-N-cyclohexyl-2-methylaniline.
| Compound Name | 3-chloro-N-cyclohexyl-2-methylaniline |
|---|---|
| PubChem CID | 29276475 |
| Molecular Formula | C13H18ClN |
| Molecular Weight | 223.75 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | 3-chloro-N-cyclohexyl-2-methylaniline |
| SMILES | Cc1c(Cl)cccc1NC1CCCCC1 |
| InChI | InChI=1S/C13H18ClN/c1-10-12(14)8-5-9-13(10)15-11-6-3-2-4-7-11/h5,8-9,11,15H,2-4,6-7H2,1H3 |
| InChIKey | LCMNXLMTNGPRMS-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.75 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |