C12H15Cl2N — CID 65469917
2,6-dichloro-N-cyclohexylaniline (PubChem CID 65469917) has the molecular formula C12H15Cl2N and a molecular weight of 244.16 g/mol. Its IUPAC name is 2,6-dichloro-N-cyclohexylaniline.
| Compound Name | 2,6-dichloro-N-cyclohexylaniline |
|---|---|
| PubChem CID | 65469917 |
| Molecular Formula | C12H15Cl2N |
| Molecular Weight | 244.16 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | 2,6-dichloro-N-cyclohexylaniline |
| SMILES | Clc1cccc(Cl)c1NC1CCCCC1 |
| InChI | InChI=1S/C12H15Cl2N/c13-10-7-4-8-11(14)12(10)15-9-5-2-1-3-6-9/h4,7-9,15H,1-3,5-6H2 |
| InChIKey | YGTIVFOYSCVLMX-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.16 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |