C17H19N5OS — CID 19146051
4-N-(1,3-benzothiazol-2-yl)-6-cyclohexyloxypyrimidine-4,5-diamine (PubChem CID 19146051) has the molecular formula C17H19N5OS and a molecular weight of 341.44 g/mol. Its IUPAC name is 4-N-(1,3-benzothiazol-2-yl)-6-cyclohexyloxypyrimidine-4,5-diamine.
| Compound Name | 4-N-(1,3-benzothiazol-2-yl)-6-cyclohexyloxypyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 19146051 |
| Molecular Formula | C17H19N5OS |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | 4-N-(1,3-benzothiazol-2-yl)-6-cyclohexyloxypyrimidine-4,5-diamine |
| SMILES | Nc1c(Nc2nc3ccccc3s2)ncnc1OC1CCCCC1 |
| InChI | InChI=1S/C17H19N5OS/c18-14-15(22-17-21-12-8-4-5-9-13(12)24-17)19-10-20-16(14)23-11-6-2-1-3-7-11/h4-5,8-11H,1-3,6-7,18H2,(H,19,20,21,22) |
| InChIKey | NZYKTROEGXNSKE-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |