C20H24ClN5 — CID 19143460
4-N-(1-adamantyl)-6-N-(3-chlorophenyl)pyrimidine-4,5,6-triamine (PubChem CID 19143460) has the molecular formula C20H24ClN5 and a molecular weight of 369.90 g/mol. Its IUPAC name is 4-N-(1-adamantyl)-6-N-(3-chlorophenyl)pyrimidine-4,5,6-triamine.
| Compound Name | 4-N-(1-adamantyl)-6-N-(3-chlorophenyl)pyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 19143460 |
| Molecular Formula | C20H24ClN5 |
| Molecular Weight | 369.90 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 4-N-(1-adamantyl)-6-N-(3-chlorophenyl)pyrimidine-4,5,6-triamine |
| SMILES | Nc1c(Nc2cccc(Cl)c2)ncnc1NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C20H24ClN5/c21-15-2-1-3-16(7-15)25-18-17(22)19(24-11-23-18)26-20-8-12-4-13(9-20)6-14(5-12)10-20/h1-3,7,11-14H,4-6,8-10,22H2,(H2,23,24,25,26) |
| InChIKey | HUWQFDNKKKLGQH-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.90 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |