C22H29N5O — CID 19143468
4-N-(1-adamantyl)-6-N-(4-ethoxyphenyl)pyrimidine-4,5,6-triamine (PubChem CID 19143468) has the molecular formula C22H29N5O and a molecular weight of 379.51 g/mol. Its IUPAC name is 4-N-(1-adamantyl)-6-N-(4-ethoxyphenyl)pyrimidine-4,5,6-triamine.
| Compound Name | 4-N-(1-adamantyl)-6-N-(4-ethoxyphenyl)pyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 19143468 |
| Molecular Formula | C22H29N5O |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 379.24 |
| IUPAC Name | 4-N-(1-adamantyl)-6-N-(4-ethoxyphenyl)pyrimidine-4,5,6-triamine |
| SMILES | CCOc1ccc(Nc2ncnc(NC34CC5CC(CC(C5)C3)C4)c2N)cc1 |
| InChI | InChI=1S/C22H29N5O/c1-2-28-18-5-3-17(4-6-18)26-20-19(23)21(25-13-24-20)27-22-10-14-7-15(11-22)9-16(8-14)12-22/h3-6,13-16H,2,7-12,23H2,1H3,(H2,24,25,26,27) |
| InChIKey | WDVHJDYOTPJDQO-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |