C14H11ClN4 — CID 5328193
4-N-(3-chlorophenyl)quinazoline-4,7-diamine (PubChem CID 5328193) has the molecular formula C14H11ClN4 and a molecular weight of 270.72 g/mol. Its IUPAC name is 4-N-(3-chlorophenyl)quinazoline-4,7-diamine.
| Compound Name | 4-N-(3-chlorophenyl)quinazoline-4,7-diamine |
|---|---|
| PubChem CID | 5328193 |
| Molecular Formula | C14H11ClN4 |
| Molecular Weight | 270.72 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 4-N-(3-chlorophenyl)quinazoline-4,7-diamine |
| SMILES | Nc1ccc2c(Nc3cccc(Cl)c3)ncnc2c1 |
| InChI | InChI=1S/C14H11ClN4/c15-9-2-1-3-11(6-9)19-14-12-5-4-10(16)7-13(12)17-8-18-14/h1-8H,16H2,(H,17,18,19) |
| InChIKey | SHJIAUOHYKFYCU-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.72 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|