C13H19Cl2N3 — CID 102755663
3,5-dichloro-6-N-(2,3-dimethylcyclohexyl)pyridine-2,6-diamine (PubChem CID 102755663) has the molecular formula C13H19Cl2N3 and a molecular weight of 288.22 g/mol. Its IUPAC name is 3,5-dichloro-6-N-(2,3-dimethylcyclohexyl)pyridine-2,6-diamine.
| Compound Name | 3,5-dichloro-6-N-(2,3-dimethylcyclohexyl)pyridine-2,6-diamine |
|---|---|
| PubChem CID | 102755663 |
| Molecular Formula | C13H19Cl2N3 |
| Molecular Weight | 288.22 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 3,5-dichloro-6-N-(2,3-dimethylcyclohexyl)pyridine-2,6-diamine |
| SMILES | CC1CCCC(Nc2nc(N)c(Cl)cc2Cl)C1C |
| InChI | InChI=1S/C13H19Cl2N3/c1-7-4-3-5-11(8(7)2)17-13-10(15)6-9(14)12(16)18-13/h6-8,11H,3-5H2,1-2H3,(H3,16,17,18) |
| InChIKey | JNCZWUFOQBSYNK-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.22 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |