C12H19ClN4 — CID 80847184
5-chloro-4-N-(2-methylcycloheptyl)pyrimidine-2,4-diamine (PubChem CID 80847184) has the molecular formula C12H19ClN4 and a molecular weight of 254.76 g/mol. Its IUPAC name is 5-chloro-4-N-(2-methylcycloheptyl)pyrimidine-2,4-diamine.
| Compound Name | 5-chloro-4-N-(2-methylcycloheptyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80847184 |
| Molecular Formula | C12H19ClN4 |
| Molecular Weight | 254.76 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 5-chloro-4-N-(2-methylcycloheptyl)pyrimidine-2,4-diamine |
| SMILES | CC1CCCCCC1Nc1nc(N)ncc1Cl |
| InChI | InChI=1S/C12H19ClN4/c1-8-5-3-2-4-6-10(8)16-11-9(13)7-15-12(14)17-11/h7-8,10H,2-6H2,1H3,(H3,14,15,16,17) |
| InChIKey | IMCYPWFFHXTUGH-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.76 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |