C10H15Cl2N3 — CID 102754467
3,5-dichloro-6-N-(3-methylbutan-2-yl)pyridine-2,6-diamine (PubChem CID 102754467) has the molecular formula C10H15Cl2N3 and a molecular weight of 248.16 g/mol. Its IUPAC name is 3,5-dichloro-6-N-(3-methylbutan-2-yl)pyridine-2,6-diamine.
| Compound Name | 3,5-dichloro-6-N-(3-methylbutan-2-yl)pyridine-2,6-diamine |
|---|---|
| PubChem CID | 102754467 |
| Molecular Formula | C10H15Cl2N3 |
| Molecular Weight | 248.16 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | 3,5-dichloro-6-N-(3-methylbutan-2-yl)pyridine-2,6-diamine |
| SMILES | CC(C)C(C)Nc1nc(N)c(Cl)cc1Cl |
| InChI | InChI=1S/C10H15Cl2N3/c1-5(2)6(3)14-10-8(12)4-7(11)9(13)15-10/h4-6H,1-3H3,(H3,13,14,15) |
| InChIKey | MJZAXJMBKRRTBV-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.16 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |