C11H17Cl2N3 — CID 102757808
3,5-dichloro-6-N-hexan-2-ylpyridine-2,6-diamine (PubChem CID 102757808) has the molecular formula C11H17Cl2N3 and a molecular weight of 262.18 g/mol. Its IUPAC name is 3,5-dichloro-6-N-hexan-2-ylpyridine-2,6-diamine.
| Compound Name | 3,5-dichloro-6-N-hexan-2-ylpyridine-2,6-diamine |
|---|---|
| PubChem CID | 102757808 |
| Molecular Formula | C11H17Cl2N3 |
| Molecular Weight | 262.18 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | 3,5-dichloro-6-N-hexan-2-ylpyridine-2,6-diamine |
| SMILES | CCCCC(C)Nc1nc(N)c(Cl)cc1Cl |
| InChI | InChI=1S/C11H17Cl2N3/c1-3-4-5-7(2)15-11-9(13)6-8(12)10(14)16-11/h6-7H,3-5H2,1-2H3,(H3,14,15,16) |
| InChIKey | BSUPDQZMEPCJFA-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.18 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |