C9H14Cl2N4 — CID 81037998
3,6-dichloro-N-hexan-2-yl-1,2,4-triazin-5-amine (PubChem CID 81037998) has the molecular formula C9H14Cl2N4 and a molecular weight of 249.14 g/mol. Its IUPAC name is 3,6-dichloro-N-hexan-2-yl-1,2,4-triazin-5-amine.
| Compound Name | 3,6-dichloro-N-hexan-2-yl-1,2,4-triazin-5-amine |
|---|---|
| PubChem CID | 81037998 |
| Molecular Formula | C9H14Cl2N4 |
| Molecular Weight | 249.14 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | 3,6-dichloro-N-hexan-2-yl-1,2,4-triazin-5-amine |
| SMILES | CCCCC(C)Nc1nc(Cl)nnc1Cl |
| InChI | InChI=1S/C9H14Cl2N4/c1-3-4-5-6(2)12-8-7(10)14-15-9(11)13-8/h6H,3-5H2,1-2H3,(H,12,13,15) |
| InChIKey | UOZURUCNDKNBDT-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.14 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |