C10H18ClN5O — CID 123847940
3-[(3-amino-6-chloro-1,2,4-triazin-5-yl)amino]heptan-1-ol (PubChem CID 123847940) has the molecular formula C10H18ClN5O and a molecular weight of 259.74 g/mol. Its IUPAC name is 3-[(3-amino-6-chloro-1,2,4-triazin-5-yl)amino]heptan-1-ol.
| Compound Name | 3-[(3-amino-6-chloro-1,2,4-triazin-5-yl)amino]heptan-1-ol |
|---|---|
| PubChem CID | 123847940 |
| Molecular Formula | C10H18ClN5O |
| Molecular Weight | 259.74 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 3-[(3-amino-6-chloro-1,2,4-triazin-5-yl)amino]heptan-1-ol |
| SMILES | CCCCC(CCO)Nc1nc(N)nnc1Cl |
| InChI | InChI=1S/C10H18ClN5O/c1-2-3-4-7(5-6-17)13-9-8(11)15-16-10(12)14-9/h7,17H,2-6H2,1H3,(H3,12,13,14,16) |
| InChIKey | NEANWUUJIMUSNL-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 96.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.74 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |