About 3-[(3-amino-6-chloro-1,2,4-triazin-5-yl)amino]heptan-1-ol
3-[(3-amino-6-chloro-1,2,4-triazin-5-yl)amino]heptan-1-ol (PubChem CID 123847940) has the molecular formula C10H18ClN5O
and a molecular weight of 259.74 g/mol. Its IUPAC name is 3-[(3-amino-6-chloro-1,2,4-triazin-5-yl)amino]heptan-1-ol.
Molecular Properties
| Compound Name | 3-[(3-amino-6-chloro-1,2,4-triazin-5-yl)amino]heptan-1-ol |
| PubChem CID | 123847940 |
| Molecular Formula | C10H18ClN5O |
| Molecular Weight | 259.74 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 3-[(3-amino-6-chloro-1,2,4-triazin-5-yl)amino]heptan-1-ol |
| SMILES | CCCCC(CCO)Nc1nc(N)nnc1Cl |
| InChI | InChI=1S/C10H18ClN5O/c1-2-3-4-7(5-6-17)13-9-8(11)15-16-10(12)14-9/h7,17H,2-6H2,1H3,(H3,12,13,14,16) |
| InChIKey | NEANWUUJIMUSNL-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 96.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.74 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[(3-amino-6-chloro-1,2,4-triazin-5-yl)amino]heptan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3-amino-6-chloro-1,2,4-triazin-5-yl)amino]heptan-1-ol?
The IUPAC name of 3-[(3-amino-6-chloro-1,2,4-triazin-5-yl)amino]heptan-1-ol (CID 123847940) is 3-[(3-amino-6-chloro-1,2,4-triazin-5-yl)amino]heptan-1-ol.
What is the SMILES notation for 3-[(3-amino-6-chloro-1,2,4-triazin-5-yl)amino]heptan-1-ol?
The canonical SMILES for 3-[(3-amino-6-chloro-1,2,4-triazin-5-yl)amino]heptan-1-ol is CCCCC(CCO)Nc1nc(N)nnc1Cl.
What is the InChIKey of 3-[(3-amino-6-chloro-1,2,4-triazin-5-yl)amino]heptan-1-ol?
The InChIKey is NEANWUUJIMUSNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18ClN5O/c1-2-3-4-7(5-6-17)13-9-8(11)15-16-10(12)14-9/h7,17H,2-6H2,1H3,(H3,12,13,14,16).
What are the key properties of 3-[(3-amino-6-chloro-1,2,4-triazin-5-yl)amino]heptan-1-ol?
3-[(3-amino-6-chloro-1,2,4-triazin-5-yl)amino]heptan-1-ol has a molecular weight of 259.74 g/mol, XLogP of 1.46, 7 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3-amino-6-chloro-1,2,4-triazin-5-yl)amino]heptan-1-ol is sourced from PubChem (CID 123847940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).