C21H29N5O2S — CID 157247821
(3S)-3-[[2-amino-5-(quinolin-2-ylmethoxy)pyrimidin-4-yl]amino]heptan-1-ol;sulfane (PubChem CID 157247821) has the molecular formula C21H29N5O2S and a molecular weight of 415.56 g/mol. Its IUPAC name is (3S)-3-[[2-amino-5-(quinolin-2-ylmethoxy)pyrimidin-4-yl]amino]heptan-1-ol;sulfane.
| Compound Name | (3S)-3-[[2-amino-5-(quinolin-2-ylmethoxy)pyrimidin-4-yl]amino]heptan-1-ol;sulfane |
|---|---|
| PubChem CID | 157247821 |
| Molecular Formula | C21H29N5O2S |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | (3S)-3-[[2-amino-5-(quinolin-2-ylmethoxy)pyrimidin-4-yl]amino]heptan-1-ol;sulfane |
| SMILES | CCCC[C@@H](CCO)Nc1nc(N)ncc1OCc1ccc2ccccc2n1.S |
| InChI | InChI=1S/C21H27N5O2.H2S/c1-2-3-7-16(11-12-27)25-20-19(13-23-21(22)26-20)28-14-17-10-9-15-6-4-5-8-18(15)24-17;/h4-6,8-10,13,16,27H,2-3,7,11-12,14H2,1H3,(H3,22,23,25,26);1H2/t16-;/m0./s1 |
| InChIKey | AVZKBMFQLWZCEP-NTISSMGPSA-N |
| XLogP | 3.65 |
| TPSA | 106.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |