C16H30N4O3 — CID 130353425
(3R)-3-[[2-amino-5-(2-propan-2-yloxyethoxy)pyrimidin-4-yl]amino]heptan-1-ol (PubChem CID 130353425) has the molecular formula C16H30N4O3 and a molecular weight of 326.44 g/mol. Its IUPAC name is (3R)-3-[[2-amino-5-(2-propan-2-yloxyethoxy)pyrimidin-4-yl]amino]heptan-1-ol.
| Compound Name | (3R)-3-[[2-amino-5-(2-propan-2-yloxyethoxy)pyrimidin-4-yl]amino]heptan-1-ol |
|---|---|
| PubChem CID | 130353425 |
| Molecular Formula | C16H30N4O3 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.23 |
| IUPAC Name | (3R)-3-[[2-amino-5-(2-propan-2-yloxyethoxy)pyrimidin-4-yl]amino]heptan-1-ol |
| SMILES | CCCC[C@H](CCO)Nc1nc(N)ncc1OCCOC(C)C |
| InChI | InChI=1S/C16H30N4O3/c1-4-5-6-13(7-8-21)19-15-14(11-18-16(17)20-15)23-10-9-22-12(2)3/h11-13,21H,4-10H2,1-3H3,(H3,17,18,19,20)/t13-/m1/s1 |
| InChIKey | ZPUDGOUVZGNVQW-CYBMUJFWSA-N |
| XLogP | 2.22 |
| TPSA | 102.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|