C15H27N5O3 — CID 130357948
3-[(2-amino-5-methoxypyrimidin-4-yl)amino]heptyl N-ethylcarbamate (PubChem CID 130357948) has the molecular formula C15H27N5O3 and a molecular weight of 325.41 g/mol. Its IUPAC name is 3-[(2-amino-5-methoxypyrimidin-4-yl)amino]heptyl N-ethylcarbamate.
| Compound Name | 3-[(2-amino-5-methoxypyrimidin-4-yl)amino]heptyl N-ethylcarbamate |
|---|---|
| PubChem CID | 130357948 |
| Molecular Formula | C15H27N5O3 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.21 |
| IUPAC Name | 3-[(2-amino-5-methoxypyrimidin-4-yl)amino]heptyl N-ethylcarbamate |
| SMILES | CCCCC(CCOC(=O)NCC)Nc1nc(N)ncc1OC |
| InChI | InChI=1S/C15H27N5O3/c1-4-6-7-11(8-9-23-15(21)17-5-2)19-13-12(22-3)10-18-14(16)20-13/h10-11H,4-9H2,1-3H3,(H,17,21)(H3,16,18,19,20) |
| InChIKey | HSLUGFUYTKSAFC-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 111.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |