C13H23N5O3 — CID 70856475
ethyl N-[2-[2-amino-4-(butylamino)pyrimidin-5-yl]oxyethyl]carbamate (PubChem CID 70856475) has the molecular formula C13H23N5O3 and a molecular weight of 297.36 g/mol. Its IUPAC name is ethyl N-[2-[2-amino-4-(butylamino)pyrimidin-5-yl]oxyethyl]carbamate.
| Compound Name | ethyl N-[2-[2-amino-4-(butylamino)pyrimidin-5-yl]oxyethyl]carbamate |
|---|---|
| PubChem CID | 70856475 |
| Molecular Formula | C13H23N5O3 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | ethyl N-[2-[2-amino-4-(butylamino)pyrimidin-5-yl]oxyethyl]carbamate |
| SMILES | CCCCNc1nc(N)ncc1OCCNC(=O)OCC |
| InChI | InChI=1S/C13H23N5O3/c1-3-5-6-15-11-10(9-17-12(14)18-11)21-8-7-16-13(19)20-4-2/h9H,3-8H2,1-2H3,(H,16,19)(H3,14,15,17,18) |
| InChIKey | AZKJNKTYTPHFKY-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 111.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|