C19H30N4O — CID 134569048
4-N-butyl-5-(5-cyclohexa-2,4-dien-1-ylpentoxy)pyrimidine-2,4-diamine (PubChem CID 134569048) has the molecular formula C19H30N4O and a molecular weight of 330.48 g/mol. Its IUPAC name is 4-N-butyl-5-(5-cyclohexa-2,4-dien-1-ylpentoxy)pyrimidine-2,4-diamine.
| Compound Name | 4-N-butyl-5-(5-cyclohexa-2,4-dien-1-ylpentoxy)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 134569048 |
| Molecular Formula | C19H30N4O |
| Molecular Weight | 330.48 g/mol |
| Exact Mass | 330.24 |
| IUPAC Name | 4-N-butyl-5-(5-cyclohexa-2,4-dien-1-ylpentoxy)pyrimidine-2,4-diamine |
| SMILES | CCCCNc1nc(N)ncc1OCCCCCC1C=CC=CC1 |
| InChI | InChI=1S/C19H30N4O/c1-2-3-13-21-18-17(15-22-19(20)23-18)24-14-9-5-8-12-16-10-6-4-7-11-16/h4,6-7,10,15-16H,2-3,5,8-9,11-14H2,1H3,(H3,20,21,22,23) |
| InChIKey | AVKBLRCXRNWIMV-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.48 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|