C20H30N4O2 — CID 134569380
4-N-butyl-5-[3-(3-ethoxy-4-methylphenyl)propoxy]pyrimidine-2,4-diamine (PubChem CID 134569380) has the molecular formula C20H30N4O2 and a molecular weight of 358.49 g/mol. Its IUPAC name is 4-N-butyl-5-[3-(3-ethoxy-4-methylphenyl)propoxy]pyrimidine-2,4-diamine.
| Compound Name | 4-N-butyl-5-[3-(3-ethoxy-4-methylphenyl)propoxy]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 134569380 |
| Molecular Formula | C20H30N4O2 |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.24 |
| IUPAC Name | 4-N-butyl-5-[3-(3-ethoxy-4-methylphenyl)propoxy]pyrimidine-2,4-diamine |
| SMILES | CCCCNc1nc(N)ncc1OCCCc1ccc(C)c(OCC)c1 |
| InChI | InChI=1S/C20H30N4O2/c1-4-6-11-22-19-18(14-23-20(21)24-19)26-12-7-8-16-10-9-15(3)17(13-16)25-5-2/h9-10,13-14H,4-8,11-12H2,1-3H3,(H3,21,22,23,24) |
| InChIKey | WPFGUXHEUHGXNV-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|