C22H34N4 — CID 134569287
4-N-butyl-5-[4-(3,4-diethylphenyl)butyl]pyrimidine-2,4-diamine (PubChem CID 134569287) has the molecular formula C22H34N4 and a molecular weight of 354.54 g/mol. Its IUPAC name is 4-N-butyl-5-[4-(3,4-diethylphenyl)butyl]pyrimidine-2,4-diamine.
| Compound Name | 4-N-butyl-5-[4-(3,4-diethylphenyl)butyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 134569287 |
| Molecular Formula | C22H34N4 |
| Molecular Weight | 354.54 g/mol |
| Exact Mass | 354.28 |
| IUPAC Name | 4-N-butyl-5-[4-(3,4-diethylphenyl)butyl]pyrimidine-2,4-diamine |
| SMILES | CCCCNc1nc(N)ncc1CCCCc1ccc(CC)c(CC)c1 |
| InChI | InChI=1S/C22H34N4/c1-4-7-14-24-21-20(16-25-22(23)26-21)11-9-8-10-17-12-13-18(5-2)19(6-3)15-17/h12-13,15-16H,4-11,14H2,1-3H3,(H3,23,24,25,26) |
| InChIKey | TWHCYPJERRDAGX-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.54 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|