C21H31N5O2 — CID 134569274
4-N-butyl-5-[2-(4-cyclopentyloxy-5-methoxy-2-pyridinyl)ethyl]pyrimidine-2,4-diamine (PubChem CID 134569274) has the molecular formula C21H31N5O2 and a molecular weight of 385.51 g/mol. Its IUPAC name is 4-N-butyl-5-[2-(4-cyclopentyloxy-5-methoxy-2-pyridinyl)ethyl]pyrimidine-2,4-diamine.
| Compound Name | 4-N-butyl-5-[2-(4-cyclopentyloxy-5-methoxy-2-pyridinyl)ethyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 134569274 |
| Molecular Formula | C21H31N5O2 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.25 |
| IUPAC Name | 4-N-butyl-5-[2-(4-cyclopentyloxy-5-methoxy-2-pyridinyl)ethyl]pyrimidine-2,4-diamine |
| SMILES | CCCCNc1nc(N)ncc1CCc1cc(OC2CCCC2)c(OC)cn1 |
| InChI | InChI=1S/C21H31N5O2/c1-3-4-11-23-20-15(13-25-21(22)26-20)9-10-16-12-18(19(27-2)14-24-16)28-17-7-5-6-8-17/h12-14,17H,3-11H2,1-2H3,(H3,22,23,25,26) |
| InChIKey | SYGFDRSJJXFSQP-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 95.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|