C14H23N — CID 115483378
4-(3,4-diethylphenyl)butan-1-amine (PubChem CID 115483378) has the molecular formula C14H23N and a molecular weight of 205.34 g/mol. Its IUPAC name is 4-(3,4-diethylphenyl)butan-1-amine.
| Compound Name | 4-(3,4-diethylphenyl)butan-1-amine |
|---|---|
| PubChem CID | 115483378 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | 4-(3,4-diethylphenyl)butan-1-amine |
| SMILES | CCc1ccc(CCCCN)cc1CC |
| InChI | InChI=1S/C14H23N/c1-3-13-9-8-12(7-5-6-10-15)11-14(13)4-2/h8-9,11H,3-7,10,15H2,1-2H3 |
| InChIKey | FLNNEQIZSKSPRB-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|