C12H19NO — CID 117284110
O-[2-(3,4-diethylphenyl)ethyl]hydroxylamine (PubChem CID 117284110) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is O-[2-(3,4-diethylphenyl)ethyl]hydroxylamine.
| Compound Name | O-[2-(3,4-diethylphenyl)ethyl]hydroxylamine |
|---|---|
| PubChem CID | 117284110 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | O-[2-(3,4-diethylphenyl)ethyl]hydroxylamine |
| SMILES | CCc1ccc(CCON)cc1CC |
| InChI | InChI=1S/C12H19NO/c1-3-11-6-5-10(7-8-14-13)9-12(11)4-2/h5-6,9H,3-4,7-8,13H2,1-2H3 |
| InChIKey | LOPSEMOFLSADCH-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|