C22H30O — CID 57139112
4-[(3,4-diethylphenyl)methoxymethyl]-1,2-diethylbenzene (PubChem CID 57139112) has the molecular formula C22H30O and a molecular weight of 310.48 g/mol. Its IUPAC name is 4-[(3,4-diethylphenyl)methoxymethyl]-1,2-diethylbenzene.
| Compound Name | 4-[(3,4-diethylphenyl)methoxymethyl]-1,2-diethylbenzene |
|---|---|
| PubChem CID | 57139112 |
| Molecular Formula | C22H30O |
| Molecular Weight | 310.48 g/mol |
| Exact Mass | 310.23 |
| IUPAC Name | 4-[(3,4-diethylphenyl)methoxymethyl]-1,2-diethylbenzene |
| SMILES | CCc1ccc(COCc2ccc(CC)c(CC)c2)cc1CC |
| InChI | InChI=1S/C22H30O/c1-5-19-11-9-17(13-21(19)7-3)15-23-16-18-10-12-20(6-2)22(8-4)14-18/h9-14H,5-8,15-16H2,1-4H3 |
| InChIKey | YNAOSVBKBYODHN-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.48 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |