C11H15ClO2S — CID 117369333
(3,4-diethylphenyl)methanesulfonyl chloride (PubChem CID 117369333) has the molecular formula C11H15ClO2S and a molecular weight of 246.76 g/mol. Its IUPAC name is (3,4-diethylphenyl)methanesulfonyl chloride.
| Compound Name | (3,4-diethylphenyl)methanesulfonyl chloride |
|---|---|
| PubChem CID | 117369333 |
| Molecular Formula | C11H15ClO2S |
| Molecular Weight | 246.76 g/mol |
| Exact Mass | 246.05 |
| IUPAC Name | (3,4-diethylphenyl)methanesulfonyl chloride |
| SMILES | CCc1ccc(CS(=O)(=O)Cl)cc1CC |
| InChI | InChI=1S/C11H15ClO2S/c1-3-10-6-5-9(7-11(10)4-2)8-15(12,13)14/h5-7H,3-4,8H2,1-2H3 |
| InChIKey | VUQWOKGFBSKHSG-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.76 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |