(3,4-diethylphenyl)methanesulfonyl chloride

C11H15ClO2S — CID 117369333

IUPAC(3,4-diethylphenyl)methanesulfonyl chloride
SMILESCCc1ccc(CS(=O)(=O)Cl)cc1CC
InChIInChI=1S/C11H15ClO2S/c1-3-10-6-5-9(7-11(10)4-2)8-15(12,13)14/h5-7H,3-4,8H2,1-2H3
InChIKeyVUQWOKGFBSKHSG-UHFFFAOYSA-N
MW246.76 g/mol
LogP2.88
Rot. Bonds4

About (3,4-diethylphenyl)methanesulfonyl chloride

(3,4-diethylphenyl)methanesulfonyl chloride (PubChem CID 117369333) has the molecular formula C11H15ClO2S and a molecular weight of 246.76 g/mol. Its IUPAC name is (3,4-diethylphenyl)methanesulfonyl chloride.

Molecular Properties

Compound Name(3,4-diethylphenyl)methanesulfonyl chloride
PubChem CID117369333
Molecular FormulaC11H15ClO2S
Molecular Weight246.76 g/mol
Exact Mass246.05
IUPAC Name(3,4-diethylphenyl)methanesulfonyl chloride
SMILESCCc1ccc(CS(=O)(=O)Cl)cc1CC
InChIInChI=1S/C11H15ClO2S/c1-3-10-6-5-9(7-11(10)4-2)8-15(12,13)14/h5-7H,3-4,8H2,1-2H3
InChIKeyVUQWOKGFBSKHSG-UHFFFAOYSA-N
XLogP2.88
TPSA34.14 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500246.76
LogP ≤ 52.88
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze (3,4-diethylphenyl)methanesulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3,4-diethylphenyl)methanesulfonyl chloride?
The IUPAC name of (3,4-diethylphenyl)methanesulfonyl chloride (CID 117369333) is (3,4-diethylphenyl)methanesulfonyl chloride.
What is the SMILES notation for (3,4-diethylphenyl)methanesulfonyl chloride?
The canonical SMILES for (3,4-diethylphenyl)methanesulfonyl chloride is CCc1ccc(CS(=O)(=O)Cl)cc1CC.
What is the InChIKey of (3,4-diethylphenyl)methanesulfonyl chloride?
The InChIKey is VUQWOKGFBSKHSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15ClO2S/c1-3-10-6-5-9(7-11(10)4-2)8-15(12,13)14/h5-7H,3-4,8H2,1-2H3.
What are the key properties of (3,4-diethylphenyl)methanesulfonyl chloride?
(3,4-diethylphenyl)methanesulfonyl chloride has a molecular weight of 246.76 g/mol, XLogP of 2.88, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3,4-diethylphenyl)methanesulfonyl chloride is sourced from PubChem (CID 117369333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).