C12H19N — CID 115482275
1-(3,4-diethylphenyl)-N-methylmethanamine (PubChem CID 115482275) has the molecular formula C12H19N and a molecular weight of 177.29 g/mol. Its IUPAC name is 1-(3,4-diethylphenyl)-N-methylmethanamine.
| Compound Name | 1-(3,4-diethylphenyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 115482275 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | 1-(3,4-diethylphenyl)-N-methylmethanamine |
| SMILES | CCc1ccc(CNC)cc1CC |
| InChI | InChI=1S/C12H19N/c1-4-11-7-6-10(9-13-3)8-12(11)5-2/h6-8,13H,4-5,9H2,1-3H3 |
| InChIKey | DHBPCOCBGCDSBH-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |